C9H17N3O3 — CID 67620460
1-N-ethyl-2-nitro-1-N'-(oxolan-3-ylmethyl)ethene-1,1-diamine (PubChem CID 67620460) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-N-ethyl-2-nitro-1-N'-(oxolan-3-ylmethyl)ethene-1,1-diamine.
| Compound Name | 1-N-ethyl-2-nitro-1-N'-(oxolan-3-ylmethyl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 67620460 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-N-ethyl-2-nitro-1-N'-(oxolan-3-ylmethyl)ethene-1,1-diamine |
| SMILES | CCNC(=C[N+](=O)[O-])NCC1CCOC1 |
| InChI | InChI=1S/C9H17N3O3/c1-2-10-9(6-12(13)14)11-5-8-3-4-15-7-8/h6,8,10-11H,2-5,7H2,1H3 |
| InChIKey | XRRCCGWTVBDWJZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|