C15H24N2O6 — CID 67620494
1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid;pyrrolidine-2,5-dione (PubChem CID 67620494) has the molecular formula C15H24N2O6 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid;pyrrolidine-2,5-dione.
| Compound Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67620494 |
| Molecular Formula | C15H24N2O6 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid;pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)O)CC1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C11H19NO4.C4H5NO2/c1-11(2,3)16-10(15)12-6-4-8(5-7-12)9(13)14;6-3-1-2-4(7)5-3/h8H,4-7H2,1-3H3,(H,13,14);1-2H2,(H,5,6,7) |
| InChIKey | GVZXHUZGUVBPSZ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|