C25H22N4O4S — CID 67621150
[5-amino-1-(2,1,3-benzothiadiazol-5-ylmethyl)-3-[4-(hydroxymethyl)phenyl]indol-2-yl] ethyl carbonate (PubChem CID 67621150) has the molecular formula C25H22N4O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is [5-amino-1-(2,1,3-benzothiadiazol-5-ylmethyl)-3-[4-(hydroxymethyl)phenyl]indol-2-yl] ethyl carbonate.
| Compound Name | [5-amino-1-(2,1,3-benzothiadiazol-5-ylmethyl)-3-[4-(hydroxymethyl)phenyl]indol-2-yl] ethyl carbonate |
|---|---|
| PubChem CID | 67621150 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | [5-amino-1-(2,1,3-benzothiadiazol-5-ylmethyl)-3-[4-(hydroxymethyl)phenyl]indol-2-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1c(-c2ccc(CO)cc2)c2cc(N)ccc2n1Cc1ccc2nsnc2c1 |
| InChI | InChI=1S/C25H22N4O4S/c1-2-32-25(31)33-24-23(17-6-3-15(14-30)4-7-17)19-12-18(26)8-10-22(19)29(24)13-16-5-9-20-21(11-16)28-34-27-20/h3-12,30H,2,13-14,26H2,1H3 |
| InChIKey | YYWFAFZMGIDNJY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|