C10H10O2 — CID 67621509
1-(2,4-dihydro-1-benzofuran-7-yl)ethanone (PubChem CID 67621509) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-(2,4-dihydro-1-benzofuran-7-yl)ethanone.
| Compound Name | 1-(2,4-dihydro-1-benzofuran-7-yl)ethanone |
|---|---|
| PubChem CID | 67621509 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 1-(2,4-dihydro-1-benzofuran-7-yl)ethanone |
| SMILES | CC(=O)C1=C2OCC=C2CC=C1 |
| InChI | InChI=1S/C10H10O2/c1-7(11)9-4-2-3-8-5-6-12-10(8)9/h2,4-5H,3,6H2,1H3 |
| InChIKey | PSIUKGKNYASBIC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |