About 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine
4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine (PubChem CID 67622400) has the molecular formula C11H13N3O2S
and a molecular weight of 251.31 g/mol. Its IUPAC name is 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine |
| PubChem CID | 67622400 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine |
| SMILES | CC1SC(N)=NC1(C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H13N3O2S/c1-7-11(2,13-10(12)17-7)8-3-5-9(6-4-8)14(15)16/h3-7H,1-2H3,(H2,12,13) |
| InChIKey | CLFQWOQSHGAJDZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine?
The IUPAC name of 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine (CID 67622400) is 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine.
What is the SMILES notation for 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine?
The canonical SMILES for 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine is CC1SC(N)=NC1(C)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine?
The InChIKey is CLFQWOQSHGAJDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2S/c1-7-11(2,13-10(12)17-7)8-3-5-9(6-4-8)14(15)16/h3-7H,1-2H3,(H2,12,13).
What are the key properties of 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine?
4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine has a molecular weight of 251.31 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-4-(4-nitrophenyl)-5H-1,3-thiazol-2-amine is sourced from PubChem (CID 67622400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).