C23H33N5O4 — CID 67622810
4-[1-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-2-yl]benzamide (PubChem CID 67622810) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-[1-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-2-yl]benzamide.
| Compound Name | 4-[1-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-2-yl]benzamide |
|---|---|
| PubChem CID | 67622810 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 4-[1-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)piperazin-2-yl]benzamide |
| SMILES | CCCCCCCCC1(N2CCNCC2c2ccc(C(N)=O)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C23H33N5O4/c1-2-3-4-5-6-7-12-23(20(30)26-22(32)27-21(23)31)28-14-13-25-15-18(28)16-8-10-17(11-9-16)19(24)29/h8-11,18,25H,2-7,12-15H2,1H3,(H2,24,29)(H2,26,27,30,31,32) |
| InChIKey | VQDOOZVVVQAJPT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|