About tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate
tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate (PubChem CID 67622874) has the molecular formula C19H26N2O3
and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate |
| PubChem CID | 67622874 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate |
| SMILES | C=Cc1cc(OC(C(=O)OC(C)(C)C)[C@@H]2CCCN2)cnc1C=C |
| InChI | InChI=1S/C19H26N2O3/c1-6-13-11-14(12-21-15(13)7-2)23-17(16-9-8-10-20-16)18(22)24-19(3,4)5/h6-7,11-12,16-17,20H,1-2,8-10H2,3-5H3/t16-,17?/m0/s1 |
| InChIKey | QZMVPHILRPHVQF-BHWOMJMDSA-N |
| XLogP | 3.21 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate?
The IUPAC name of tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate (CID 67622874) is tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate.
What is the SMILES notation for tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate?
The canonical SMILES for tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate is C=Cc1cc(OC(C(=O)OC(C)(C)C)[C@@H]2CCCN2)cnc1C=C.
What is the InChIKey of tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate?
The InChIKey is QZMVPHILRPHVQF-BHWOMJMDSA-N. The full InChI is InChI=1S/C19H26N2O3/c1-6-13-11-14(12-21-15(13)7-2)23-17(16-9-8-10-20-16)18(22)24-19(3,4)5/h6-7,11-12,16-17,20H,1-2,8-10H2,3-5H3/t16-,17?/m0/s1.
What are the key properties of tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate?
tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate has a molecular weight of 330.43 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[[5,6-bis(ethenyl)-3-pyridinyl]oxy]-2-[(2S)-pyrrolidin-2-yl]acetate is sourced from PubChem (CID 67622874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).