About 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide
2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide (PubChem CID 67623192) has the molecular formula C18H19Cl2NO3S
and a molecular weight of 400.33 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide.
Molecular Properties
| Compound Name | 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide |
| PubChem CID | 67623192 |
| Molecular Formula | C18H19Cl2NO3S |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide |
| SMILES | CS(=O)(=O)CCC(Cc1ccccc1C(N)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2NO3S/c1-25(23,24)9-8-13(12-6-7-16(19)17(20)11-12)10-14-4-2-3-5-15(14)18(21)22/h2-7,11,13H,8-10H2,1H3,(H2,21,22) |
| InChIKey | RMRAEKPVMLPHKA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide?
The IUPAC name of 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide (CID 67623192) is 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide.
What is the SMILES notation for 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide?
The canonical SMILES for 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide is CS(=O)(=O)CCC(Cc1ccccc1C(N)=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide?
The InChIKey is RMRAEKPVMLPHKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl2NO3S/c1-25(23,24)9-8-13(12-6-7-16(19)17(20)11-12)10-14-4-2-3-5-15(14)18(21)22/h2-7,11,13H,8-10H2,1H3,(H2,21,22).
What are the key properties of 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide?
2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide has a molecular weight of 400.33 g/mol, XLogP of 3.85, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dichlorophenyl)-4-methylsulfonylbutyl]benzamide is sourced from PubChem (CID 67623192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).