C21H18FNO4 — CID 67623568
ethyl (1R,3R)-3-(1,3-dioxoisoindol-2-yl)-7-fluoro-1,2,3,4-tetrahydronaphthalene-1-carboxylate (PubChem CID 67623568) has the molecular formula C21H18FNO4 and a molecular weight of 367.38 g/mol. Its IUPAC name is ethyl (1R,3R)-3-(1,3-dioxoisoindol-2-yl)-7-fluoro-1,2,3,4-tetrahydronaphthalene-1-carboxylate.
| Compound Name | ethyl (1R,3R)-3-(1,3-dioxoisoindol-2-yl)-7-fluoro-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 67623568 |
| Molecular Formula | C21H18FNO4 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | ethyl (1R,3R)-3-(1,3-dioxoisoindol-2-yl)-7-fluoro-1,2,3,4-tetrahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](N2C(=O)c3ccccc3C2=O)Cc2ccc(F)cc21 |
| InChI | InChI=1S/C21H18FNO4/c1-2-27-21(26)18-11-14(9-12-7-8-13(22)10-17(12)18)23-19(24)15-5-3-4-6-16(15)20(23)25/h3-8,10,14,18H,2,9,11H2,1H3/t14-,18+/m0/s1 |
| InChIKey | PWTJTTCOKOCKEX-KBXCAEBGSA-N |
| XLogP | 3.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|