About sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid
sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid (PubChem CID 67624152) has the molecular formula C8H8N3NaO3S
and a molecular weight of 249.23 g/mol. Its IUPAC name is sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid |
| PubChem CID | 67624152 |
| Molecular Formula | C8H8N3NaO3S |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid |
| SMILES | C[O-].O=C(O)c1sccc1-n1cnnc1.[Na+] |
| InChI | InChI=1S/C7H5N3O2S.CH3O.Na/c11-7(12)6-5(1-2-13-6)10-3-8-9-4-10;1-2;/h1-4H,(H,11,12);1H3;/q;-1;+1 |
| InChIKey | DPOKGNOENMAPIZ-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid?
The IUPAC name of sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid (CID 67624152) is sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid.
What is the SMILES notation for sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid?
The canonical SMILES for sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid is C[O-].O=C(O)c1sccc1-n1cnnc1.[Na+].
What is the InChIKey of sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid?
The InChIKey is DPOKGNOENMAPIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2S.CH3O.Na/c11-7(12)6-5(1-2-13-6)10-3-8-9-4-10;1-2;/h1-4H,(H,11,12);1H3;/q;-1;+1.
What are the key properties of sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid?
sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid has a molecular weight of 249.23 g/mol, XLogP of -2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;methanolate;3-(1,2,4-triazol-4-yl)thiophene-2-carboxylic acid is sourced from PubChem (CID 67624152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).