C22H19N5OS — CID 67624379
N-[(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]pyridine-3-carboxamide (PubChem CID 67624379) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is N-[(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67624379 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | N-[(2-phenyl-5,6,7,8-tetrahydroimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(NN=Cc1c(-c2ccccc2)nc2sc3c(n12)CCCC3)c1cccnc1 |
| InChI | InChI=1S/C22H19N5OS/c28-21(16-9-6-12-23-13-16)26-24-14-18-20(15-7-2-1-3-8-15)25-22-27(18)17-10-4-5-11-19(17)29-22/h1-3,6-9,12-14H,4-5,10-11H2,(H,26,28) |
| InChIKey | CEWXYVSZQWBPFS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|