About 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene
5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene (PubChem CID 67624395) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene.
Analyze 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene?
The IUPAC name of 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene (CID 67624395) is 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene.
What is the SMILES notation for 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene?
The canonical SMILES for 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene is C1=CN=C2CCC=NC3=CCCCC32C1.
What is the InChIKey of 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene?
The InChIKey is COGCTOFGLAWGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-2-7-13-8-4-10-15-12(13)6-3-9-14-11(13)5-1/h4-5,9-10H,1-3,6-8H2.
What are the key properties of 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene?
5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene has a molecular weight of 200.28 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-diazatricyclo[9.4.0.01,6]pentadeca-3,5,9,11-tetraene is sourced from PubChem (CID 67624395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).