C26H21NO5 — CID 67625357
methyl 2-[2-amino-1-(6-hydroxynaphthalen-2-yl)oxy-2-oxo-1-phenylethyl]benzoate (PubChem CID 67625357) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is methyl 2-[2-amino-1-(6-hydroxynaphthalen-2-yl)oxy-2-oxo-1-phenylethyl]benzoate.
| Compound Name | methyl 2-[2-amino-1-(6-hydroxynaphthalen-2-yl)oxy-2-oxo-1-phenylethyl]benzoate |
|---|---|
| PubChem CID | 67625357 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | methyl 2-[2-amino-1-(6-hydroxynaphthalen-2-yl)oxy-2-oxo-1-phenylethyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(Oc1ccc2cc(O)ccc2c1)(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C26H21NO5/c1-31-24(29)22-9-5-6-10-23(22)26(25(27)30,19-7-3-2-4-8-19)32-21-14-12-17-15-20(28)13-11-18(17)16-21/h2-16,28H,1H3,(H2,27,30) |
| InChIKey | OOSJPHSUDJNZSA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |