C42H42N2O6 — CID 67625505
9-ethyl-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid;6-phenylmethoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid (PubChem CID 67625505) has the molecular formula C42H42N2O6 and a molecular weight of 670.81 g/mol. Its IUPAC name is 9-ethyl-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid;6-phenylmethoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid.
| Compound Name | 9-ethyl-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid;6-phenylmethoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 67625505 |
| Molecular Formula | C42H42N2O6 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | 9-ethyl-6-phenylmethoxy-1,2,3,4-tetrahydrocarbazole-3-carboxylic acid;6-phenylmethoxy-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylic acid |
| SMILES | CCn1c2c(c3cc(OCc4ccccc4)ccc31)CC(C(=O)O)CC2.O=C(O)C1CCc2[nH]c3ccc(OCc4ccccc4)cc3c2C1 |
| InChI | InChI=1S/C22H23NO3.C20H19NO3/c1-2-23-20-10-8-16(22(24)25)12-18(20)19-13-17(9-11-21(19)23)26-14-15-6-4-3-5-7-15;22-20(23)14-6-8-18-16(10-14)17-11-15(7-9-19(17)21-18)24-12-13-4-2-1-3-5-13/h3-7,9,11,13,16H,2,8,10,12,14H2,1H3,(H,24,25);1-5,7,9,11,14,21H,6,8,10,12H2,(H,22,23) |
| InChIKey | MWZFHOMORRBLGS-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|