About benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate
benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 67625561) has the molecular formula C22H25NO2
and a molecular weight of 335.45 g/mol. Its IUPAC name is benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate |
| PubChem CID | 67625561 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CCC/C=C/C1Cc2ccccc2N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C22H25NO2/c1-2-3-5-12-19-15-20-13-8-9-14-21(20)23(16-19)22(24)25-17-18-10-6-4-7-11-18/h4-14,19H,2-3,15-17H2,1H3/b12-5+ |
| InChIKey | ILNHMVNWMWWRFN-LFYBBSHMSA-N |
| XLogP | 5.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate?
The IUPAC name of benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate (CID 67625561) is benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate.
What is the SMILES notation for benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate?
The canonical SMILES for benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate is CCC/C=C/C1Cc2ccccc2N(C(=O)OCc2ccccc2)C1.
What is the InChIKey of benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate?
The InChIKey is ILNHMVNWMWWRFN-LFYBBSHMSA-N. The full InChI is InChI=1S/C22H25NO2/c1-2-3-5-12-19-15-20-13-8-9-14-21(20)23(16-19)22(24)25-17-18-10-6-4-7-11-18/h4-14,19H,2-3,15-17H2,1H3/b12-5+.
What are the key properties of benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate?
benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate has a molecular weight of 335.45 g/mol, XLogP of 5.36, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-[(E)-pent-1-enyl]-3,4-dihydro-2H-quinoline-1-carboxylate is sourced from PubChem (CID 67625561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).