About anthracene-9,10-dione;2-methylpyridine;hydrobromide
anthracene-9,10-dione;2-methylpyridine;hydrobromide (PubChem CID 67625699) has the molecular formula C20H16BrNO2
and a molecular weight of 382.26 g/mol. Its IUPAC name is anthracene-9,10-dione;2-methylpyridine;hydrobromide.
Molecular Properties
| Compound Name | anthracene-9,10-dione;2-methylpyridine;hydrobromide |
| PubChem CID | 67625699 |
| Molecular Formula | C20H16BrNO2 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | anthracene-9,10-dione;2-methylpyridine;hydrobromide |
| SMILES | Br.Cc1ccccn1.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H8O2.C6H7N.BrH/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-6-4-2-3-5-7-6;/h1-8H;2-5H,1H3;1H |
| InChIKey | NOWSLXROXAMBSM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dione;2-methylpyridine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dione;2-methylpyridine;hydrobromide?
The IUPAC name of anthracene-9,10-dione;2-methylpyridine;hydrobromide (CID 67625699) is anthracene-9,10-dione;2-methylpyridine;hydrobromide.
What is the SMILES notation for anthracene-9,10-dione;2-methylpyridine;hydrobromide?
The canonical SMILES for anthracene-9,10-dione;2-methylpyridine;hydrobromide is Br.Cc1ccccn1.O=C1c2ccccc2C(=O)c2ccccc21.
What is the InChIKey of anthracene-9,10-dione;2-methylpyridine;hydrobromide?
The InChIKey is NOWSLXROXAMBSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2.C6H7N.BrH/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-6-4-2-3-5-7-6;/h1-8H;2-5H,1H3;1H.
What are the key properties of anthracene-9,10-dione;2-methylpyridine;hydrobromide?
anthracene-9,10-dione;2-methylpyridine;hydrobromide has a molecular weight of 382.26 g/mol, XLogP of 4.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dione;2-methylpyridine;hydrobromide is sourced from PubChem (CID 67625699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).