About ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate
ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate (PubChem CID 67625710) has the molecular formula C27H24O2S
and a molecular weight of 412.55 g/mol. Its IUPAC name is ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate.
Molecular Properties
| Compound Name | ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate |
| PubChem CID | 67625710 |
| Molecular Formula | C27H24O2S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate |
| SMILES | C=COC(=O)c1ccccc1-c1cccc2c1C(Sc1ccccc1)=CCC2(C)C |
| InChI | InChI=1S/C27H24O2S/c1-4-29-26(28)22-14-9-8-13-20(22)21-15-10-16-23-25(21)24(17-18-27(23,2)3)30-19-11-6-5-7-12-19/h4-17H,1,18H2,2-3H3 |
| InChIKey | BHOFOSYHXTVJHT-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate?
The IUPAC name of ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate (CID 67625710) is ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate.
What is the SMILES notation for ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate?
The canonical SMILES for ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate is C=COC(=O)c1ccccc1-c1cccc2c1C(Sc1ccccc1)=CCC2(C)C.
What is the InChIKey of ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate?
The InChIKey is BHOFOSYHXTVJHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24O2S/c1-4-29-26(28)22-14-9-8-13-20(22)21-15-10-16-23-25(21)24(17-18-27(23,2)3)30-19-11-6-5-7-12-19/h4-17H,1,18H2,2-3H3.
What are the key properties of ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate?
ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate has a molecular weight of 412.55 g/mol, XLogP of 7.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 2-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-1-yl)benzoate is sourced from PubChem (CID 67625710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).