About (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile
(E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile (PubChem CID 67625811) has the molecular formula C22H21NS
and a molecular weight of 331.48 g/mol. Its IUPAC name is (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile.
Molecular Properties
| Compound Name | (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile |
| PubChem CID | 67625811 |
| Molecular Formula | C22H21NS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile |
| SMILES | CC1(C)CC=C(Sc2ccccc2)c2cc(C/C=C/C#N)ccc21 |
| InChI | InChI=1S/C22H21NS/c1-22(2)14-13-21(24-18-9-4-3-5-10-18)19-16-17(8-6-7-15-23)11-12-20(19)22/h3-7,9-13,16H,8,14H2,1-2H3/b7-6+ |
| InChIKey | OOAFCGHOMAHNIL-VOTSOKGWSA-N |
| XLogP | 6.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile?
The IUPAC name of (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile (CID 67625811) is (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile.
What is the SMILES notation for (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile?
The canonical SMILES for (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile is CC1(C)CC=C(Sc2ccccc2)c2cc(C/C=C/C#N)ccc21.
What is the InChIKey of (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile?
The InChIKey is OOAFCGHOMAHNIL-VOTSOKGWSA-N. The full InChI is InChI=1S/C22H21NS/c1-22(2)14-13-21(24-18-9-4-3-5-10-18)19-16-17(8-6-7-15-23)11-12-20(19)22/h3-7,9-13,16H,8,14H2,1-2H3/b7-6+.
What are the key properties of (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile?
(E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile has a molecular weight of 331.48 g/mol, XLogP of 6.12, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(5,5-dimethyl-8-phenylsulfanyl-6H-naphthalen-2-yl)but-2-enenitrile is sourced from PubChem (CID 67625811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).