C36H53NO5Si — CID 67625916
tert-butyl N-[(1S)-1-[(2S,4R)-4-but-2-enyl-5-oxooxolan-2-yl]-5-[tert-butyl(diphenyl)silyl]oxy-3,3-dimethylpentyl]carbamate (PubChem CID 67625916) has the molecular formula C36H53NO5Si and a molecular weight of 607.91 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[(2S,4R)-4-but-2-enyl-5-oxooxolan-2-yl]-5-[tert-butyl(diphenyl)silyl]oxy-3,3-dimethylpentyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[(2S,4R)-4-but-2-enyl-5-oxooxolan-2-yl]-5-[tert-butyl(diphenyl)silyl]oxy-3,3-dimethylpentyl]carbamate |
|---|---|
| PubChem CID | 67625916 |
| Molecular Formula | C36H53NO5Si |
| Molecular Weight | 607.91 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(2S,4R)-4-but-2-enyl-5-oxooxolan-2-yl]-5-[tert-butyl(diphenyl)silyl]oxy-3,3-dimethylpentyl]carbamate |
| SMILES | CC=CC[C@@H]1C[C@@H]([C@H](CC(C)(C)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)NC(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C36H53NO5Si/c1-10-11-18-27-25-31(41-32(27)38)30(37-33(39)42-34(2,3)4)26-36(8,9)23-24-40-43(35(5,6)7,28-19-14-12-15-20-28)29-21-16-13-17-22-29/h10-17,19-22,27,30-31H,18,23-26H2,1-9H3,(H,37,39)/t27-,30+,31+/m1/s1 |
| InChIKey | LBBDRPLZPLXZCR-RDAHNBDFSA-N |
| XLogP | 7.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.91 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|