C39H59NO6Si — CID 67626350
(2R)-2-[[(4S,5S)-4-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl]-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]methyl]hex-4-enoic acid (PubChem CID 67626350) has the molecular formula C39H59NO6Si and a molecular weight of 665.99 g/mol. Its IUPAC name is (2R)-2-[[(4S,5S)-4-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl]-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]methyl]hex-4-enoic acid.
| Compound Name | (2R)-2-[[(4S,5S)-4-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl]-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]methyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 67626350 |
| Molecular Formula | C39H59NO6Si |
| Molecular Weight | 665.99 g/mol |
| Exact Mass | 665.41 |
| IUPAC Name | (2R)-2-[[(4S,5S)-4-[4-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethylbutyl]-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]methyl]hex-4-enoic acid |
| SMILES | CC=CC[C@H](C[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CC(C)(C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C39H59NO6Si/c1-12-13-20-29(34(41)42)27-33-32(40(39(10,11)45-33)35(43)46-36(2,3)4)28-38(8,9)25-26-44-47(37(5,6)7,30-21-16-14-17-22-30)31-23-18-15-19-24-31/h12-19,21-24,29,32-33H,20,25-28H2,1-11H3,(H,41,42)/t29-,32+,33+/m1/s1 |
| InChIKey | YEBAUBNFBSLXAE-CDSZWMAJSA-N |
| XLogP | 8.17 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.99 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|