C13H17ClF2O3 — CID 67626439
(2E)-4-chloro-1-cyclohexyl-2-(ethoxymethylidene)-4,4-difluorobutane-1,3-dione (PubChem CID 67626439) has the molecular formula C13H17ClF2O3 and a molecular weight of 294.73 g/mol. Its IUPAC name is (2E)-4-chloro-1-cyclohexyl-2-(ethoxymethylidene)-4,4-difluorobutane-1,3-dione.
| Compound Name | (2E)-4-chloro-1-cyclohexyl-2-(ethoxymethylidene)-4,4-difluorobutane-1,3-dione |
|---|---|
| PubChem CID | 67626439 |
| Molecular Formula | C13H17ClF2O3 |
| Molecular Weight | 294.73 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2E)-4-chloro-1-cyclohexyl-2-(ethoxymethylidene)-4,4-difluorobutane-1,3-dione |
| SMILES | CCO/C=C(\C(=O)C1CCCCC1)C(=O)C(F)(F)Cl |
| InChI | InChI=1S/C13H17ClF2O3/c1-2-19-8-10(12(18)13(14,15)16)11(17)9-6-4-3-5-7-9/h8-9H,2-7H2,1H3/b10-8+ |
| InChIKey | HZJDHCIQIQCPGI-CSKARUKUSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|