About dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate
dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate (PubChem CID 67626799) has the molecular formula C13H17O5P
and a molecular weight of 284.25 g/mol. Its IUPAC name is dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate.
Molecular Properties
| Compound Name | dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate |
| PubChem CID | 67626799 |
| Molecular Formula | C13H17O5P |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate |
| SMILES | COP(=O)(OC)OC(=O)/C(C)=C(/C)c1ccccc1 |
| InChI | InChI=1S/C13H17O5P/c1-10(12-8-6-5-7-9-12)11(2)13(14)18-19(15,16-3)17-4/h5-9H,1-4H3/b11-10- |
| InChIKey | YNUGOOVZZBBZNU-KHPPLWFESA-N |
| XLogP | 3.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate?
The IUPAC name of dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate (CID 67626799) is dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate.
What is the SMILES notation for dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate?
The canonical SMILES for dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate is COP(=O)(OC)OC(=O)/C(C)=C(/C)c1ccccc1.
What is the InChIKey of dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate?
The InChIKey is YNUGOOVZZBBZNU-KHPPLWFESA-N. The full InChI is InChI=1S/C13H17O5P/c1-10(12-8-6-5-7-9-12)11(2)13(14)18-19(15,16-3)17-4/h5-9H,1-4H3/b11-10-.
What are the key properties of dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate?
dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate has a molecular weight of 284.25 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxyphosphoryl (Z)-2-methyl-3-phenylbut-2-enoate is sourced from PubChem (CID 67626799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).