About butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol
butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol (PubChem CID 67627243) has the molecular formula C35H44N2O3S
and a molecular weight of 572.82 g/mol. Its IUPAC name is butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol.
Molecular Properties
| Compound Name | butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol |
| PubChem CID | 67627243 |
| Molecular Formula | C35H44N2O3S |
| Molecular Weight | 572.82 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol |
| SMILES | CCCCOC(=O)C1(c2ccccc2)CCN(CCC(C#N)(c2ccccc2)c2ccccc2)CC1.CSCCO |
| InChI | InChI=1S/C32H36N2O2.C3H8OS/c1-2-3-25-36-30(35)31(27-13-7-4-8-14-27)19-22-34(23-20-31)24-21-32(26-33,28-15-9-5-10-16-28)29-17-11-6-12-18-29;1-5-3-2-4/h4-18H,2-3,19-25H2,1H3;4H,2-3H2,1H3 |
| InChIKey | SGWZKFLZOTYVSO-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.82 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol?
The IUPAC name of butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol (CID 67627243) is butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol.
What is the SMILES notation for butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol?
The canonical SMILES for butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol is CCCCOC(=O)C1(c2ccccc2)CCN(CCC(C#N)(c2ccccc2)c2ccccc2)CC1.CSCCO.
What is the InChIKey of butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol?
The InChIKey is SGWZKFLZOTYVSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H36N2O2.C3H8OS/c1-2-3-25-36-30(35)31(27-13-7-4-8-14-27)19-22-34(23-20-31)24-21-32(26-33,28-15-9-5-10-16-28)29-17-11-6-12-18-29;1-5-3-2-4/h4-18H,2-3,19-25H2,1H3;4H,2-3H2,1H3.
What are the key properties of butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol?
butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol has a molecular weight of 572.82 g/mol, XLogP of 6.61, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylate;2-methylsulfanylethanol is sourced from PubChem (CID 67627243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).