About ethanol;pyrrolidin-2-one;1,2-xylene
ethanol;pyrrolidin-2-one;1,2-xylene (PubChem CID 67627345) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is ethanol;pyrrolidin-2-one;1,2-xylene.
Molecular Properties
| Compound Name | ethanol;pyrrolidin-2-one;1,2-xylene |
| PubChem CID | 67627345 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | ethanol;pyrrolidin-2-one;1,2-xylene |
| SMILES | CCO.Cc1ccccc1C.O=C1CCCN1 |
| InChI | InChI=1S/C8H10.C4H7NO.C2H6O/c1-7-5-3-4-6-8(7)2;6-4-2-1-3-5-4;1-2-3/h3-6H,1-2H3;1-3H2,(H,5,6);3H,2H2,1H3 |
| InChIKey | DTFFYJWCTDHAGT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;pyrrolidin-2-one;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;pyrrolidin-2-one;1,2-xylene?
The IUPAC name of ethanol;pyrrolidin-2-one;1,2-xylene (CID 67627345) is ethanol;pyrrolidin-2-one;1,2-xylene.
What is the SMILES notation for ethanol;pyrrolidin-2-one;1,2-xylene?
The canonical SMILES for ethanol;pyrrolidin-2-one;1,2-xylene is CCO.Cc1ccccc1C.O=C1CCCN1.
What is the InChIKey of ethanol;pyrrolidin-2-one;1,2-xylene?
The InChIKey is DTFFYJWCTDHAGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C4H7NO.C2H6O/c1-7-5-3-4-6-8(7)2;6-4-2-1-3-5-4;1-2-3/h3-6H,1-2H3;1-3H2,(H,5,6);3H,2H2,1H3.
What are the key properties of ethanol;pyrrolidin-2-one;1,2-xylene?
ethanol;pyrrolidin-2-one;1,2-xylene has a molecular weight of 237.34 g/mol, XLogP of 2.20, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;pyrrolidin-2-one;1,2-xylene is sourced from PubChem (CID 67627345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).