C18H25NO7 — CID 67627357
diethyl 2-acetamido-2-[(3,5-dimethoxyphenyl)methyl]propanedioate (PubChem CID 67627357) has the molecular formula C18H25NO7 and a molecular weight of 367.40 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[(3,5-dimethoxyphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-acetamido-2-[(3,5-dimethoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 67627357 |
| Molecular Formula | C18H25NO7 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | diethyl 2-acetamido-2-[(3,5-dimethoxyphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1cc(OC)cc(OC)c1)(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C18H25NO7/c1-6-25-16(21)18(19-12(3)20,17(22)26-7-2)11-13-8-14(23-4)10-15(9-13)24-5/h8-10H,6-7,11H2,1-5H3,(H,19,20) |
| InChIKey | HJFICOPBTOTXSN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|