C31H27F3N4O2 — CID 67628180
2-amino-3-(6-benzamido-3-pyridinyl)-1-propyl-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide (PubChem CID 67628180) has the molecular formula C31H27F3N4O2 and a molecular weight of 544.58 g/mol. Its IUPAC name is 2-amino-3-(6-benzamido-3-pyridinyl)-1-propyl-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide.
| Compound Name | 2-amino-3-(6-benzamido-3-pyridinyl)-1-propyl-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide |
|---|---|
| PubChem CID | 67628180 |
| Molecular Formula | C31H27F3N4O2 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | 2-amino-3-(6-benzamido-3-pyridinyl)-1-propyl-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide |
| SMILES | CCCc1c(N)c(-c2ccc(NC(=O)c3ccccc3)nc2)cc2c1C(C(=O)NCC(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C31H27F3N4O2/c1-2-8-22-26-24(20-11-6-7-12-21(20)27(26)30(40)37-17-31(32,33)34)15-23(28(22)35)19-13-14-25(36-16-19)38-29(39)18-9-4-3-5-10-18/h3-7,9-16,27H,2,8,17,35H2,1H3,(H,37,40)(H,36,38,39) |
| InChIKey | OXMGXZHXVJFOQE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|