About 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate
3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate (PubChem CID 67628654) has the molecular formula C26H33NO3
and a molecular weight of 407.55 g/mol. Its IUPAC name is 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate.
Molecular Properties
| Compound Name | 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate |
| PubChem CID | 67628654 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate |
| SMILES | CCC(C(=O)OCCCOC(c1ccccc1)c1ccccc1)=C1CCNCC1C |
| InChI | InChI=1S/C26H33NO3/c1-3-23(24-15-16-27-19-20(24)2)26(28)30-18-10-17-29-25(21-11-6-4-7-12-21)22-13-8-5-9-14-22/h4-9,11-14,20,25,27H,3,10,15-19H2,1-2H3 |
| InChIKey | SOQQTMSLXQPYCT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate?
The IUPAC name of 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate (CID 67628654) is 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate.
What is the SMILES notation for 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate?
The canonical SMILES for 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate is CCC(C(=O)OCCCOC(c1ccccc1)c1ccccc1)=C1CCNCC1C.
What is the InChIKey of 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate?
The InChIKey is SOQQTMSLXQPYCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H33NO3/c1-3-23(24-15-16-27-19-20(24)2)26(28)30-18-10-17-29-25(21-11-6-4-7-12-21)22-13-8-5-9-14-22/h4-9,11-14,20,25,27H,3,10,15-19H2,1-2H3.
What are the key properties of 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate?
3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate has a molecular weight of 407.55 g/mol, XLogP of 5.06, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzhydryloxypropyl 2-(3-methylpiperidin-4-ylidene)butanoate is sourced from PubChem (CID 67628654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).