C29H36F3NO5P+ — CID 67628982
[1-(4-butoxybutyl)-9-(2,2,2-trifluoroethylcarbamoyl)-9H-fluoren-2-yl]-oxo-(oxolan-2-ylmethoxy)phosphanium (PubChem CID 67628982) has the molecular formula C29H36F3NO5P+ and a molecular weight of 566.58 g/mol. Its IUPAC name is [1-(4-butoxybutyl)-9-(2,2,2-trifluoroethylcarbamoyl)-9H-fluoren-2-yl]-oxo-(oxolan-2-ylmethoxy)phosphanium.
| Compound Name | [1-(4-butoxybutyl)-9-(2,2,2-trifluoroethylcarbamoyl)-9H-fluoren-2-yl]-oxo-(oxolan-2-ylmethoxy)phosphanium |
|---|---|
| PubChem CID | 67628982 |
| Molecular Formula | C29H36F3NO5P+ |
| Molecular Weight | 566.58 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | [1-(4-butoxybutyl)-9-(2,2,2-trifluoroethylcarbamoyl)-9H-fluoren-2-yl]-oxo-(oxolan-2-ylmethoxy)phosphanium |
| SMILES | CCCCOCCCCc1c([P+](=O)OCC2CCCO2)ccc2c1C(C(=O)NCC(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C29H35F3NO5P/c1-2-3-15-36-16-7-6-12-24-25(39(35)38-18-20-9-8-17-37-20)14-13-23-21-10-4-5-11-22(21)27(26(23)24)28(34)33-19-29(30,31)32/h4-5,10-11,13-14,20,27H,2-3,6-9,12,15-19H2,1H3/p+1 |
| InChIKey | ZDQWGCXIFLIJOL-UHFFFAOYSA-O |
| XLogP | 6.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|