C24H33NO3S — CID 67629832
(2S)-2-[[(2S,3S)-2-(2-adamantylsulfanylmethyl)-3-phenylbutanoyl]amino]propanoic acid (PubChem CID 67629832) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-2-(2-adamantylsulfanylmethyl)-3-phenylbutanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S,3S)-2-(2-adamantylsulfanylmethyl)-3-phenylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67629832 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (2S)-2-[[(2S,3S)-2-(2-adamantylsulfanylmethyl)-3-phenylbutanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](CSC1C2CC3CC(C2)CC1C3)[C@H](C)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H33NO3S/c1-14(18-6-4-3-5-7-18)21(23(26)25-15(2)24(27)28)13-29-22-19-9-16-8-17(11-19)12-20(22)10-16/h3-7,14-17,19-22H,8-13H2,1-2H3,(H,25,26)(H,27,28)/t14-,15+,16?,17?,19?,20?,21+,22?/m1/s1 |
| InChIKey | VUDKPJMNLVHNRQ-ABYSZXCXSA-N |
| XLogP | 4.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |