C37H48N6O3 — CID 67629853
(2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[4-[(2S,5S)-5-(4-aminophenyl)-1-(4-morpholin-4-ylphenyl)pyrrolidin-2-yl]phenyl]pyrrolidine-2-carboxamide (PubChem CID 67629853) has the molecular formula C37H48N6O3 and a molecular weight of 624.83 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[4-[(2S,5S)-5-(4-aminophenyl)-1-(4-morpholin-4-ylphenyl)pyrrolidin-2-yl]phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[4-[(2S,5S)-5-(4-aminophenyl)-1-(4-morpholin-4-ylphenyl)pyrrolidin-2-yl]phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67629853 |
| Molecular Formula | C37H48N6O3 |
| Molecular Weight | 624.83 g/mol |
| Exact Mass | 624.38 |
| IUPAC Name | (2S)-1-[(2S)-2-amino-3,3-dimethylbutanoyl]-N-[4-[(2S,5S)-5-(4-aminophenyl)-1-(4-morpholin-4-ylphenyl)pyrrolidin-2-yl]phenyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1CCC[C@H]1C(=O)Nc1ccc([C@@H]2CC[C@@H](c3ccc(N)cc3)N2c2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C37H48N6O3/c1-37(2,3)34(39)36(45)42-20-4-5-33(42)35(44)40-28-12-8-26(9-13-28)32-19-18-31(25-6-10-27(38)11-7-25)43(32)30-16-14-29(15-17-30)41-21-23-46-24-22-41/h6-17,31-34H,4-5,18-24,38-39H2,1-3H3,(H,40,44)/t31-,32-,33-,34+/m0/s1 |
| InChIKey | NRMGIWPOSZUVJQ-GZXHTMMISA-N |
| XLogP | 5.49 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.83 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|