C24H34N4O5S — CID 67629900
N-[[4-[2-(2-hexoxyethoxy)ethylcarbamoyl]phenyl]methyl]-5-(hydrazinecarbonyl)thiophene-2-carboxamide (PubChem CID 67629900) has the molecular formula C24H34N4O5S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-[[4-[2-(2-hexoxyethoxy)ethylcarbamoyl]phenyl]methyl]-5-(hydrazinecarbonyl)thiophene-2-carboxamide.
| Compound Name | N-[[4-[2-(2-hexoxyethoxy)ethylcarbamoyl]phenyl]methyl]-5-(hydrazinecarbonyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 67629900 |
| Molecular Formula | C24H34N4O5S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[[4-[2-(2-hexoxyethoxy)ethylcarbamoyl]phenyl]methyl]-5-(hydrazinecarbonyl)thiophene-2-carboxamide |
| SMILES | CCCCCCOCCOCCNC(=O)c1ccc(CNC(=O)c2ccc(C(=O)NN)s2)cc1 |
| InChI | InChI=1S/C24H34N4O5S/c1-2-3-4-5-13-32-15-16-33-14-12-26-22(29)19-8-6-18(7-9-19)17-27-23(30)20-10-11-21(34-20)24(31)28-25/h6-11H,2-5,12-17,25H2,1H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | GMPRCBCYUWPBEB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|