About bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione
bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione (PubChem CID 67630482) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione |
| PubChem CID | 67630482 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione |
| SMILES | C1CC2CCC1C2.CC1=C(C)C(=O)NC1=O |
| InChI | InChI=1S/C7H12.C6H7NO2/c1-2-7-4-3-6(1)5-7;1-3-4(2)6(9)7-5(3)8/h6-7H,1-5H2;1-2H3,(H,7,8,9) |
| InChIKey | DQMORAYNWMZSPJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione?
The IUPAC name of bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione (CID 67630482) is bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione.
What is the SMILES notation for bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione?
The canonical SMILES for bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione is C1CC2CCC1C2.CC1=C(C)C(=O)NC1=O.
What is the InChIKey of bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione?
The InChIKey is DQMORAYNWMZSPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C6H7NO2/c1-2-7-4-3-6(1)5-7;1-3-4(2)6(9)7-5(3)8/h6-7H,1-5H2;1-2H3,(H,7,8,9).
What are the key properties of bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione?
bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione has a molecular weight of 221.30 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane;3,4-dimethylpyrrole-2,5-dione is sourced from PubChem (CID 67630482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).