C28H31ClN2O4 — CID 67631032
5-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 2-O-methyl pyridine-2,5-dicarboxylate;hydrochloride (PubChem CID 67631032) has the molecular formula C28H31ClN2O4 and a molecular weight of 495.02 g/mol. Its IUPAC name is 5-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 2-O-methyl pyridine-2,5-dicarboxylate;hydrochloride.
| Compound Name | 5-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 2-O-methyl pyridine-2,5-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 67631032 |
| Molecular Formula | C28H31ClN2O4 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 5-O-[3-(4,4-diphenylpiperidin-1-yl)propyl] 2-O-methyl pyridine-2,5-dicarboxylate;hydrochloride |
| SMILES | COC(=O)c1ccc(C(=O)OCCCN2CCC(c3ccccc3)(c3ccccc3)CC2)cn1.Cl |
| InChI | InChI=1S/C28H30N2O4.ClH/c1-33-27(32)25-14-13-22(21-29-25)26(31)34-20-8-17-30-18-15-28(16-19-30,23-9-4-2-5-10-23)24-11-6-3-7-12-24;/h2-7,9-14,21H,8,15-20H2,1H3;1H |
| InChIKey | SCYBFFIKTUZNCY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|