C42H32N4O7 — CID 67631081
[(2S,4S,6R)-2-[(1,3-dioxoisoindol-2-yl)methyl]-6-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]oxan-4-yl] benzoate (PubChem CID 67631081) has the molecular formula C42H32N4O7 and a molecular weight of 704.74 g/mol. Its IUPAC name is [(2S,4S,6R)-2-[(1,3-dioxoisoindol-2-yl)methyl]-6-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]oxan-4-yl] benzoate.
| Compound Name | [(2S,4S,6R)-2-[(1,3-dioxoisoindol-2-yl)methyl]-6-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 67631081 |
| Molecular Formula | C42H32N4O7 |
| Molecular Weight | 704.74 g/mol |
| Exact Mass | 704.23 |
| IUPAC Name | [(2S,4S,6R)-2-[(1,3-dioxoisoindol-2-yl)methyl]-6-[3-[4-(1-methylindol-3-yl)-2,5-dioxopyrrol-3-yl]indol-1-yl]oxan-4-yl] benzoate |
| SMILES | Cn1cc(C2=C(c3cn([C@H]4C[C@@H](OC(=O)c5ccccc5)C[C@@H](CN5C(=O)c6ccccc6C5=O)O4)c4ccccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C42H32N4O7/c1-44-22-31(27-13-7-9-17-33(27)44)36-37(39(48)43-38(36)47)32-23-45(34-18-10-8-14-28(32)34)35-20-25(53-42(51)24-11-3-2-4-12-24)19-26(52-35)21-46-40(49)29-15-5-6-16-30(29)41(46)50/h2-18,22-23,25-26,35H,19-21H2,1H3,(H,43,47,48)/t25-,26-,35+/m0/s1 |
| InChIKey | SKVLDHWXLGOBNO-SFXKCFQESA-N |
| XLogP | 5.90 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|