C35H43ClN4O3 — CID 67631086
1-butyl-1-[4-[3-(4-chlorobutoxy)phenyl]-2-oxo-1H-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 67631086) has the molecular formula C35H43ClN4O3 and a molecular weight of 603.21 g/mol. Its IUPAC name is 1-butyl-1-[4-[3-(4-chlorobutoxy)phenyl]-2-oxo-1H-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-butyl-1-[4-[3-(4-chlorobutoxy)phenyl]-2-oxo-1H-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 67631086 |
| Molecular Formula | C35H43ClN4O3 |
| Molecular Weight | 603.21 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | 1-butyl-1-[4-[3-(4-chlorobutoxy)phenyl]-2-oxo-1H-1,8-naphthyridin-3-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CCCCN(C(=O)Nc1c(C(C)C)cccc1C(C)C)c1c(-c2cccc(OCCCCCl)c2)c2cccnc2[nH]c1=O |
| InChI | InChI=1S/C35H43ClN4O3/c1-6-7-20-40(35(42)38-31-27(23(2)3)15-11-16-28(31)24(4)5)32-30(29-17-12-19-37-33(29)39-34(32)41)25-13-10-14-26(22-25)43-21-9-8-18-36/h10-17,19,22-24H,6-9,18,20-21H2,1-5H3,(H,38,42)(H,37,39,41) |
| InChIKey | PKCNYTPPWYYQSN-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.21 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|