About 4-piperidin-1-yl-1,2-dihydroindol-4-ol
4-piperidin-1-yl-1,2-dihydroindol-4-ol (PubChem CID 67631463) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-piperidin-1-yl-1,2-dihydroindol-4-ol.
Molecular Properties
| Compound Name | 4-piperidin-1-yl-1,2-dihydroindol-4-ol |
| PubChem CID | 67631463 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-piperidin-1-yl-1,2-dihydroindol-4-ol |
| SMILES | OC1(N2CCCCC2)C=CC=C2NCC=C21 |
| InChI | InChI=1S/C13H18N2O/c16-13(15-9-2-1-3-10-15)7-4-5-12-11(13)6-8-14-12/h4-7,14,16H,1-3,8-10H2 |
| InChIKey | HAAQAUVBZGHXBI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-piperidin-1-yl-1,2-dihydroindol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-1-yl-1,2-dihydroindol-4-ol?
The IUPAC name of 4-piperidin-1-yl-1,2-dihydroindol-4-ol (CID 67631463) is 4-piperidin-1-yl-1,2-dihydroindol-4-ol.
What is the SMILES notation for 4-piperidin-1-yl-1,2-dihydroindol-4-ol?
The canonical SMILES for 4-piperidin-1-yl-1,2-dihydroindol-4-ol is OC1(N2CCCCC2)C=CC=C2NCC=C21.
What is the InChIKey of 4-piperidin-1-yl-1,2-dihydroindol-4-ol?
The InChIKey is HAAQAUVBZGHXBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c16-13(15-9-2-1-3-10-15)7-4-5-12-11(13)6-8-14-12/h4-7,14,16H,1-3,8-10H2.
What are the key properties of 4-piperidin-1-yl-1,2-dihydroindol-4-ol?
4-piperidin-1-yl-1,2-dihydroindol-4-ol has a molecular weight of 218.30 g/mol, XLogP of 1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-1-yl-1,2-dihydroindol-4-ol is sourced from PubChem (CID 67631463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).