About methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate
methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate (PubChem CID 67631520) has the molecular formula C17H26O4
and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate.
Molecular Properties
| Compound Name | methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate |
| PubChem CID | 67631520 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate |
| SMILES | CCCCCOC=C1CC=CC=C1C(O)(CC)C(=O)OC |
| InChI | InChI=1S/C17H26O4/c1-4-6-9-12-21-13-14-10-7-8-11-15(14)17(19,5-2)16(18)20-3/h7-8,11,13,19H,4-6,9-10,12H2,1-3H3 |
| InChIKey | XSYIZHWGJLNWEI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate?
The IUPAC name of methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate (CID 67631520) is methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate.
What is the SMILES notation for methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate?
The canonical SMILES for methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate is CCCCCOC=C1CC=CC=C1C(O)(CC)C(=O)OC.
What is the InChIKey of methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate?
The InChIKey is XSYIZHWGJLNWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O4/c1-4-6-9-12-21-13-14-10-7-8-11-15(14)17(19,5-2)16(18)20-3/h7-8,11,13,19H,4-6,9-10,12H2,1-3H3.
What are the key properties of methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate?
methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate has a molecular weight of 294.39 g/mol, XLogP of 3.28, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-hydroxy-2-[6-(pentoxymethylidene)cyclohexa-1,3-dien-1-yl]butanoate is sourced from PubChem (CID 67631520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).