About ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate
ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate (PubChem CID 67631902) has the molecular formula C16H20FN3O2
and a molecular weight of 305.35 g/mol. Its IUPAC name is ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate |
| PubChem CID | 67631902 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate |
| SMILES | CCOC(=O)NC1=CCC(N)(NCc2ccc(F)cc2)C=C1 |
| InChI | InChI=1S/C16H20FN3O2/c1-2-22-15(21)20-14-7-9-16(18,10-8-14)19-11-12-3-5-13(17)6-4-12/h3-9,19H,2,10-11,18H2,1H3,(H,20,21) |
| InChIKey | CKMYBWFAEDRURO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate?
The IUPAC name of ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate (CID 67631902) is ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate.
What is the SMILES notation for ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate?
The canonical SMILES for ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate is CCOC(=O)NC1=CCC(N)(NCc2ccc(F)cc2)C=C1.
What is the InChIKey of ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate?
The InChIKey is CKMYBWFAEDRURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20FN3O2/c1-2-22-15(21)20-14-7-9-16(18,10-8-14)19-11-12-3-5-13(17)6-4-12/h3-9,19H,2,10-11,18H2,1H3,(H,20,21).
What are the key properties of ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate?
ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate has a molecular weight of 305.35 g/mol, XLogP of 2.16, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[4-amino-4-[(4-fluorophenyl)methylamino]cyclohexa-1,5-dien-1-yl]carbamate is sourced from PubChem (CID 67631902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).