About methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate
methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate (PubChem CID 67631978) has the molecular formula C22H17F2NO5
and a molecular weight of 413.38 g/mol. Its IUPAC name is methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate |
| PubChem CID | 67631978 |
| Molecular Formula | C22H17F2NO5 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(/C(=O)OC)c1ccccc1Oc1ccnc(Oc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C22H17F2NO5/c1-27-13-16(22(26)28-2)15-6-3-4-9-19(15)29-14-10-11-25-20(12-14)30-21-17(23)7-5-8-18(21)24/h3-13H,1-2H3/b16-13+ |
| InChIKey | HBFHLXUZZKESJM-DTQAZKPQSA-N |
| XLogP | 5.10 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate?
The IUPAC name of methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate (CID 67631978) is methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate.
What is the SMILES notation for methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate?
The canonical SMILES for methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate is CO/C=C(/C(=O)OC)c1ccccc1Oc1ccnc(Oc2c(F)cccc2F)c1.
What is the InChIKey of methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate?
The InChIKey is HBFHLXUZZKESJM-DTQAZKPQSA-N. The full InChI is InChI=1S/C22H17F2NO5/c1-27-13-16(22(26)28-2)15-6-3-4-9-19(15)29-14-10-11-25-20(12-14)30-21-17(23)7-5-8-18(21)24/h3-13H,1-2H3/b16-13+.
What are the key properties of methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate?
methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate has a molecular weight of 413.38 g/mol, XLogP of 5.10, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methoxyprop-2-enoate is sourced from PubChem (CID 67631978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).