About 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid
2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid (PubChem CID 67631983) has the molecular formula C22H17F2NO4
and a molecular weight of 397.38 g/mol. Its IUPAC name is 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid.
Molecular Properties
| Compound Name | 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid |
| PubChem CID | 67631983 |
| Molecular Formula | C22H17F2NO4 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid |
| SMILES | CC(C)=C(C(=O)O)c1ccccc1Oc1ccnc(Oc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C22H17F2NO4/c1-13(2)20(22(26)27)15-6-3-4-9-18(15)28-14-10-11-25-19(12-14)29-21-16(23)7-5-8-17(21)24/h3-12H,1-2H3,(H,26,27) |
| InChIKey | XQSJPGJSFLJNFH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid?
The IUPAC name of 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid (CID 67631983) is 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid.
What is the SMILES notation for 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid?
The canonical SMILES for 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid is CC(C)=C(C(=O)O)c1ccccc1Oc1ccnc(Oc2c(F)cccc2F)c1.
What is the InChIKey of 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid?
The InChIKey is XQSJPGJSFLJNFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F2NO4/c1-13(2)20(22(26)27)15-6-3-4-9-18(15)28-14-10-11-25-19(12-14)29-21-16(23)7-5-8-17(21)24/h3-12H,1-2H3,(H,26,27).
What are the key properties of 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid?
2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid has a molecular weight of 397.38 g/mol, XLogP of 5.82, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[2-(2,6-difluorophenoxy)-4-pyridinyl]oxy]phenyl]-3-methylbut-2-enoic acid is sourced from PubChem (CID 67631983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).