About imidazo[4,5-i][1,5]benzodiazepine
imidazo[4,5-i][1,5]benzodiazepine (PubChem CID 67632074) has the molecular formula C10H6N4
and a molecular weight of 182.19 g/mol. Its IUPAC name is imidazo[4,5-i][1,5]benzodiazepine.
Molecular Properties
| Compound Name | imidazo[4,5-i][1,5]benzodiazepine |
| PubChem CID | 67632074 |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | imidazo[4,5-i][1,5]benzodiazepine |
| SMILES | c1cnc2ccc3ncnc3c2nc1 |
| InChI | InChI=1S/C10H6N4/c1-4-11-7-2-3-8-10(14-6-13-8)9(7)12-5-1/h1-6H |
| InChIKey | HVPZWNWGSWWVIW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[4,5-i][1,5]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[4,5-i][1,5]benzodiazepine?
The IUPAC name of imidazo[4,5-i][1,5]benzodiazepine (CID 67632074) is imidazo[4,5-i][1,5]benzodiazepine.
What is the SMILES notation for imidazo[4,5-i][1,5]benzodiazepine?
The canonical SMILES for imidazo[4,5-i][1,5]benzodiazepine is c1cnc2ccc3ncnc3c2nc1.
What is the InChIKey of imidazo[4,5-i][1,5]benzodiazepine?
The InChIKey is HVPZWNWGSWWVIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4/c1-4-11-7-2-3-8-10(14-6-13-8)9(7)12-5-1/h1-6H.
What are the key properties of imidazo[4,5-i][1,5]benzodiazepine?
imidazo[4,5-i][1,5]benzodiazepine has a molecular weight of 182.19 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[4,5-i][1,5]benzodiazepine is sourced from PubChem (CID 67632074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).