C39H47N5O2 — CID 67632282
3-[4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2,6-di(propan-2-yl)phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)-1-pent-4-enylurea (PubChem CID 67632282) has the molecular formula C39H47N5O2 and a molecular weight of 617.84 g/mol. Its IUPAC name is 3-[4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2,6-di(propan-2-yl)phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)-1-pent-4-enylurea.
| Compound Name | 3-[4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2,6-di(propan-2-yl)phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)-1-pent-4-enylurea |
|---|---|
| PubChem CID | 67632282 |
| Molecular Formula | C39H47N5O2 |
| Molecular Weight | 617.84 g/mol |
| Exact Mass | 617.37 |
| IUPAC Name | 3-[4-[3-[3-(diethylamino)prop-1-ynyl]phenyl]-2,6-di(propan-2-yl)phenyl]-1-(2-oxo-1H-1,8-naphthyridin-3-yl)-1-pent-4-enylurea |
| SMILES | C=CCCCN(C(=O)Nc1c(C(C)C)cc(-c2cccc(C#CCN(CC)CC)c2)cc1C(C)C)c1cc2cccnc2[nH]c1=O |
| InChI | InChI=1S/C39H47N5O2/c1-8-11-12-22-44(35-26-31-19-14-20-40-37(31)42-38(35)45)39(46)41-36-33(27(4)5)24-32(25-34(36)28(6)7)30-18-13-16-29(23-30)17-15-21-43(9-2)10-3/h8,13-14,16,18-20,23-28H,1,9-12,21-22H2,2-7H3,(H,41,46)(H,40,42,45) |
| InChIKey | MZTZKAQMNVJOTP-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.84 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|