About (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid (PubChem CID 67632359) has the molecular formula C22H28N4O5
and a molecular weight of 428.49 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid |
| PubChem CID | 67632359 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid |
| SMILES | CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H14O3.C6H14N4O2/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12;7-4(5(11)12)2-1-3-10-6(8)9/h2-11H,1H3,(H,18,19);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1 |
| InChIKey | BIIRZGCJVPVBQJ-VWMHFEHESA-N |
| XLogP | 1.56 |
| TPSA | 182.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid?
The IUPAC name of (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid (CID 67632359) is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid?
The canonical SMILES for (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid is CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1.NC(N)=NCCC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid?
The InChIKey is BIIRZGCJVPVBQJ-VWMHFEHESA-N. The full InChI is InChI=1S/C16H14O3.C6H14N4O2/c1-11(16(18)19)13-8-5-9-14(10-13)15(17)12-6-3-2-4-7-12;7-4(5(11)12)2-1-3-10-6(8)9/h2-11H,1H3,(H,18,19);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t;4-/m.0/s1.
What are the key properties of (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid?
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid has a molecular weight of 428.49 g/mol, XLogP of 1.56, 9 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-(3-benzoylphenyl)propanoic acid is sourced from PubChem (CID 67632359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).