C37H49N5O4 — CID 67632397
3-[4-[3-[3-(diethylamino)propoxy]phenyl]-2,6-di(propan-2-yl)phenyl]-1-(3-hydroxypropyl)-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea (PubChem CID 67632397) has the molecular formula C37H49N5O4 and a molecular weight of 627.83 g/mol. Its IUPAC name is 3-[4-[3-[3-(diethylamino)propoxy]phenyl]-2,6-di(propan-2-yl)phenyl]-1-(3-hydroxypropyl)-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea.
| Compound Name | 3-[4-[3-[3-(diethylamino)propoxy]phenyl]-2,6-di(propan-2-yl)phenyl]-1-(3-hydroxypropyl)-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea |
|---|---|
| PubChem CID | 67632397 |
| Molecular Formula | C37H49N5O4 |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.38 |
| IUPAC Name | 3-[4-[3-[3-(diethylamino)propoxy]phenyl]-2,6-di(propan-2-yl)phenyl]-1-(3-hydroxypropyl)-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea |
| SMILES | CCN(CC)CCCOc1cccc(-c2cc(C(C)C)c(NC(=O)N(CCCO)c3cc4cccnc4[nH]c3=O)c(C(C)C)c2)c1 |
| InChI | InChI=1S/C37H49N5O4/c1-7-41(8-2)17-12-20-46-30-15-9-13-27(21-30)29-22-31(25(3)4)34(32(23-29)26(5)6)39-37(45)42(18-11-19-43)33-24-28-14-10-16-38-35(28)40-36(33)44/h9-10,13-16,21-26,43H,7-8,11-12,17-20H2,1-6H3,(H,39,45)(H,38,40,44) |
| InChIKey | RHRSXENXYASTBF-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|