C40H47N5O3 — CID 67632760
3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-3-ylpropoxy)phenyl]phenyl]-1-(3-methylbutyl)-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea (PubChem CID 67632760) has the molecular formula C40H47N5O3 and a molecular weight of 645.85 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-3-ylpropoxy)phenyl]phenyl]-1-(3-methylbutyl)-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea.
| Compound Name | 3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-3-ylpropoxy)phenyl]phenyl]-1-(3-methylbutyl)-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea |
|---|---|
| PubChem CID | 67632760 |
| Molecular Formula | C40H47N5O3 |
| Molecular Weight | 645.85 g/mol |
| Exact Mass | 645.37 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)-4-[3-(3-pyridin-3-ylpropoxy)phenyl]phenyl]-1-(3-methylbutyl)-1-(2-oxo-1H-1,8-naphthyridin-3-yl)urea |
| SMILES | CC(C)CCN(C(=O)Nc1c(C(C)C)cc(-c2cccc(OCCCc3cccnc3)c2)cc1C(C)C)c1cc2cccnc2[nH]c1=O |
| InChI | InChI=1S/C40H47N5O3/c1-26(2)16-19-45(36-24-31-14-9-18-42-38(31)44-39(36)46)40(47)43-37-34(27(3)4)22-32(23-35(37)28(5)6)30-13-7-15-33(21-30)48-20-10-12-29-11-8-17-41-25-29/h7-9,11,13-15,17-18,21-28H,10,12,16,19-20H2,1-6H3,(H,43,47)(H,42,44,46) |
| InChIKey | HBJJJYCIDPAYOW-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.85 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|