C36H46N4O3 — CID 67633082
3-[2,6-di(propan-2-yl)phenyl]-1-[4-(3-methoxyphenyl)-2-oxo-1H-1,8-naphthyridin-3-yl]-1-octylurea (PubChem CID 67633082) has the molecular formula C36H46N4O3 and a molecular weight of 582.79 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-1-[4-(3-methoxyphenyl)-2-oxo-1H-1,8-naphthyridin-3-yl]-1-octylurea.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-1-[4-(3-methoxyphenyl)-2-oxo-1H-1,8-naphthyridin-3-yl]-1-octylurea |
|---|---|
| PubChem CID | 67633082 |
| Molecular Formula | C36H46N4O3 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-1-[4-(3-methoxyphenyl)-2-oxo-1H-1,8-naphthyridin-3-yl]-1-octylurea |
| SMILES | CCCCCCCCN(C(=O)Nc1c(C(C)C)cccc1C(C)C)c1c(-c2cccc(OC)c2)c2cccnc2[nH]c1=O |
| InChI | InChI=1S/C36H46N4O3/c1-7-8-9-10-11-12-22-40(36(42)38-32-28(24(2)3)18-14-19-29(32)25(4)5)33-31(26-16-13-17-27(23-26)43-6)30-20-15-21-37-34(30)39-35(33)41/h13-21,23-25H,7-12,22H2,1-6H3,(H,38,42)(H,37,39,41) |
| InChIKey | IIRAZNIARKPACQ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|