C26H36O2S — CID 67633198
(8S,9R,10S,13R,14S)-10,13-dimethyl-16-(4-methylsulfanylphenoxy)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67633198) has the molecular formula C26H36O2S and a molecular weight of 412.64 g/mol. Its IUPAC name is (8S,9R,10S,13R,14S)-10,13-dimethyl-16-(4-methylsulfanylphenoxy)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13R,14S)-10,13-dimethyl-16-(4-methylsulfanylphenoxy)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67633198 |
| Molecular Formula | C26H36O2S |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (8S,9R,10S,13R,14S)-10,13-dimethyl-16-(4-methylsulfanylphenoxy)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CSc1ccc(OC2C[C@H]3[C@@H]4CCC5CC(=O)CC[C@]5(C)[C@@H]4CC[C@]3(C)C2)cc1 |
| InChI | InChI=1S/C26H36O2S/c1-25-12-11-23-22(9-4-17-14-18(27)10-13-26(17,23)2)24(25)15-20(16-25)28-19-5-7-21(29-3)8-6-19/h5-8,17,20,22-24H,4,9-16H2,1-3H3/t17?,20?,22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | XMAGIASZBPWVJD-TZIUNPAMSA-N |
| XLogP | 6.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |