About 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene
5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene (PubChem CID 67633739) has the molecular formula C18H14N4S2
and a molecular weight of 350.47 g/mol. Its IUPAC name is 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene |
| PubChem CID | 67633739 |
| Molecular Formula | C18H14N4S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene |
| SMILES | c1ccc(/N=N/NN(c2ccccc2)c2cc3sccc3s2)cc1 |
| InChI | InChI=1S/C18H14N4S2/c1-3-7-14(8-4-1)19-20-21-22(15-9-5-2-6-10-15)18-13-17-16(24-18)11-12-23-17/h1-13H,(H,19,21) |
| InChIKey | HUQPLNWIJWNJRZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene?
The IUPAC name of 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene (CID 67633739) is 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene.
What is the SMILES notation for 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene?
The canonical SMILES for 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene is c1ccc(/N=N/NN(c2ccccc2)c2cc3sccc3s2)cc1.
What is the InChIKey of 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene?
The InChIKey is HUQPLNWIJWNJRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N4S2/c1-3-7-14(8-4-1)19-20-21-22(15-9-5-2-6-10-15)18-13-17-16(24-18)11-12-23-17/h1-13H,(H,19,21).
What are the key properties of 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene?
5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene has a molecular weight of 350.47 g/mol, XLogP of 6.30, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(N-(2-phenyliminohydrazinyl)anilino)thieno[3,2-b]thiophene is sourced from PubChem (CID 67633739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).