C12H17NO3 — CID 67634230
butyl N-[(4-hydroxyphenyl)methyl]carbamate (PubChem CID 67634230) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is butyl N-[(4-hydroxyphenyl)methyl]carbamate.
| Compound Name | butyl N-[(4-hydroxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 67634230 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | butyl N-[(4-hydroxyphenyl)methyl]carbamate |
| SMILES | CCCCOC(=O)NCc1ccc(O)cc1 |
| InChI | InChI=1S/C12H17NO3/c1-2-3-8-16-12(15)13-9-10-4-6-11(14)7-5-10/h4-7,14H,2-3,8-9H2,1H3,(H,13,15) |
| InChIKey | FZFDSYCYLNDUCN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|