C14H11NO4 — CID 67634501
2,2-dihydroxyindene-1,3-dione;pyridine (PubChem CID 67634501) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2,2-dihydroxyindene-1,3-dione;pyridine.
| Compound Name | 2,2-dihydroxyindene-1,3-dione;pyridine |
|---|---|
| PubChem CID | 67634501 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2,2-dihydroxyindene-1,3-dione;pyridine |
| SMILES | O=C1c2ccccc2C(=O)C1(O)O.c1ccncc1 |
| InChI | InChI=1S/C9H6O4.C5H5N/c10-7-5-3-1-2-4-6(5)8(11)9(7,12)13;1-2-4-6-5-3-1/h1-4,12-13H;1-5H |
| InChIKey | MLTIQCDXIKEEEK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|